C10H13N4+ — CID 91145326
hepta-2,4,6-trien-2-yl-methylidene-(1H-1,2,4-triazol-5-yl)azanium (PubChem CID 91145326) has the molecular formula C10H13N4+ and a molecular weight of 189.24 g/mol. Its IUPAC name is hepta-2,4,6-trien-2-yl-methylidene-(1H-1,2,4-triazol-5-yl)azanium.
| Compound Name | hepta-2,4,6-trien-2-yl-methylidene-(1H-1,2,4-triazol-5-yl)azanium |
|---|---|
| PubChem CID | 91145326 |
| Molecular Formula | C10H13N4+ |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | hepta-2,4,6-trien-2-yl-methylidene-(1H-1,2,4-triazol-5-yl)azanium |
| SMILES | C=CC=CC=C(C)[N+](=C)c1ncn[nH]1 |
| InChI | InChI=1S/C10H13N4/c1-4-5-6-7-9(2)14(3)10-11-8-12-13-10/h4-8H,1,3H2,2H3,(H,11,12,13)/q+1 |
| InChIKey | KIODGXVWXARSBM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|