ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate

C18H24FNO2 — CID 91145440

IUPACethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate
SMILESCC.CC.COC(=O)c1cnccc1Cc1cccc(F)c1
InChIInChI=1S/C14H12FNO2.2C2H6/c1-18-14(17)13-9-16-6-5-11(13)7-10-3-2-4-12(15)8-10;2*1-2/h2-6,8-9H,7H2,1H3;2*1-2H3
InChIKeyTZNOTOFXQZHGPS-UHFFFAOYSA-N
MW305.39 g/mol
LogP4.65
Rot. Bonds3

About ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate

ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate (PubChem CID 91145440) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate.

Molecular Properties

Compound Nameethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate
PubChem CID91145440
Molecular FormulaC18H24FNO2
Molecular Weight305.39 g/mol
Exact Mass305.18
IUPAC Nameethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate
SMILESCC.CC.COC(=O)c1cnccc1Cc1cccc(F)c1
InChIInChI=1S/C14H12FNO2.2C2H6/c1-18-14(17)13-9-16-6-5-11(13)7-10-3-2-4-12(15)8-10;2*1-2/h2-6,8-9H,7H2,1H3;2*1-2H3
InChIKeyTZNOTOFXQZHGPS-UHFFFAOYSA-N
XLogP4.65
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.39
LogP ≤ 54.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate?
The IUPAC name of ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate (CID 91145440) is ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate.
What is the SMILES notation for ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate?
The canonical SMILES for ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate is CC.CC.COC(=O)c1cnccc1Cc1cccc(F)c1.
What is the InChIKey of ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate?
The InChIKey is TZNOTOFXQZHGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO2.2C2H6/c1-18-14(17)13-9-16-6-5-11(13)7-10-3-2-4-12(15)8-10;2*1-2/h2-6,8-9H,7H2,1H3;2*1-2H3.
What are the key properties of ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate?
ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate has a molecular weight of 305.39 g/mol, XLogP of 4.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-[(3-fluorophenyl)methyl]pyridine-3-carboxylate is sourced from PubChem (CID 91145440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).