About 7-ethoxyheptanamide
7-ethoxyheptanamide (PubChem CID 91145527) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 7-ethoxyheptanamide.
Molecular Properties
| Compound Name | 7-ethoxyheptanamide |
| PubChem CID | 91145527 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 7-ethoxyheptanamide |
| SMILES | CCOCCCCCCC(N)=O |
| InChI | InChI=1S/C9H19NO2/c1-2-12-8-6-4-3-5-7-9(10)11/h2-8H2,1H3,(H2,10,11) |
| InChIKey | CRLXTRYMPKAPRG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-ethoxyheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxyheptanamide?
The IUPAC name of 7-ethoxyheptanamide (CID 91145527) is 7-ethoxyheptanamide.
What is the SMILES notation for 7-ethoxyheptanamide?
The canonical SMILES for 7-ethoxyheptanamide is CCOCCCCCCC(N)=O.
What is the InChIKey of 7-ethoxyheptanamide?
The InChIKey is CRLXTRYMPKAPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-2-12-8-6-4-3-5-7-9(10)11/h2-8H2,1H3,(H2,10,11).
What are the key properties of 7-ethoxyheptanamide?
7-ethoxyheptanamide has a molecular weight of 173.26 g/mol, XLogP of 1.46, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxyheptanamide is sourced from PubChem (CID 91145527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).