C17H28O2 — CID 91145533
1-(2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulen-6-yl)hexane-1,2-dione (PubChem CID 91145533) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulen-6-yl)hexane-1,2-dione.
| Compound Name | 1-(2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulen-6-yl)hexane-1,2-dione |
|---|---|
| PubChem CID | 91145533 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulen-6-yl)hexane-1,2-dione |
| SMILES | CCCCC(=O)C(=O)C1CCCC2CCCCC2C1 |
| InChI | InChI=1S/C17H28O2/c1-2-3-11-16(18)17(19)15-10-6-9-13-7-4-5-8-14(13)12-15/h13-15H,2-12H2,1H3 |
| InChIKey | PBZQHKKTUZWPEK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|