C54H66N6O6 — CID 91145570
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2S,6R)-4-hydroxy-2,6-dimethyloxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide (PubChem CID 91145570) has the molecular formula C54H66N6O6 and a molecular weight of 895.16 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2S,6R)-4-hydroxy-2,6-dimethyloxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2S,6R)-4-hydroxy-2,6-dimethyloxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 91145570 |
| Molecular Formula | C54H66N6O6 |
| Molecular Weight | 895.16 g/mol |
| Exact Mass | 894.50 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2S,6R)-4-hydroxy-2,6-dimethyloxan-4-yl]phenyl]-5-ethynyl-1H-imidazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(=O)Nc2ccc(C3(O)C[C@@H](C)O[C@@H](C)C3)cc2C2=CCC(C)(C)CC2)[nH]1.C#Cc1cnc(C(=O)Nc2ccc(C3(O)C[C@@H](C)O[C@@H](C)C3)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/2C27H33N3O3/c2*1-6-21-16-28-24(29-21)25(31)30-23-8-7-20(27(32)14-17(2)33-18(3)15-27)13-22(23)19-9-11-26(4,5)12-10-19/h2*1,7-9,13,16-18,32H,10-12,14-15H2,2-5H3,(H,28,29)(H,30,31)/t2*17-,18+,27? |
| InChIKey | IVNZJRZNRKETRL-ZHYSJQILSA-N |
| XLogP | 10.02 |
| TPSA | 174.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.16 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|