About N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine
N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine (PubChem CID 91145865) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine.
Molecular Properties
| Compound Name | N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine |
| PubChem CID | 91145865 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine |
| SMILES | C=S(=O)(NC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H10N2O3S/c1-9-14(2,13)8-5-3-7(4-6-8)10(11)12/h3-6H,2H2,1H3,(H,9,13) |
| InChIKey | GMPZNWGKVFHIPY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine?
The IUPAC name of N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine (CID 91145865) is N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine.
What is the SMILES notation for N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine?
The canonical SMILES for N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine is C=S(=O)(NC)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine?
The InChIKey is GMPZNWGKVFHIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-9-14(2,13)8-5-3-7(4-6-8)10(11)12/h3-6H,2H2,1H3,(H,9,13).
What are the key properties of N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine?
N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine has a molecular weight of 214.25 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[methylidene-(4-nitrophenyl)-oxo-λ6-sulfanyl]methanamine is sourced from PubChem (CID 91145865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).