C29H23N5O5 — CID 91146416
5-[5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-1,3,4-trienyl]-4,7-dimethyl-2-phenyl-1H-pyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 91146416) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is 5-[5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-1,3,4-trienyl]-4,7-dimethyl-2-phenyl-1H-pyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 5-[5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-1,3,4-trienyl]-4,7-dimethyl-2-phenyl-1H-pyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 91146416 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 5-[5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-1,3,4-trienyl]-4,7-dimethyl-2-phenyl-1H-pyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | Cc1c(C=CC=C=Cc2c(O)n(-c3ccccc3)c(=O)[nH]c2=O)c(=O)n(C)c2[nH]n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C29H23N5O5/c1-18-21(26(36)32(2)24-23(18)28(38)34(31-24)20-14-8-4-9-15-20)16-10-5-11-17-22-25(35)30-29(39)33(27(22)37)19-12-6-3-7-13-19/h3-10,12-17,31,37H,1-2H3,(H,30,35,39) |
| InChIKey | FQCXCOJRDLDUOD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|