C23H32N2O4 — CID 91146516
tert-butyl (1R,10R)-12-oxospiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane (PubChem CID 91146516) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl (1R,10R)-12-oxospiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane.
| Compound Name | tert-butyl (1R,10R)-12-oxospiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane |
|---|---|
| PubChem CID | 91146516 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl (1R,10R)-12-oxospiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,3'-azetidine]-1'-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC2(C[C@@H]3CC(=O)N4CCO[C@@]34c3ccccc32)C1 |
| InChI | InChI=1S/C21H26N2O4.C2H6/c1-19(2,3)27-18(25)22-12-20(13-22)11-14-10-17(24)23-8-9-26-21(14,23)16-7-5-4-6-15(16)20;1-2/h4-7,14H,8-13H2,1-3H3;1-2H3/t14-,21+;/m0./s1 |
| InChIKey | AGDQHYDGHZDCON-ZOLBUBSWSA-N |
| XLogP | 3.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |