C8H10NS+ — CID 91146648
2-methyl-3,3a,4,5-tetrahydro-2H-1,3-benzothiazol-5-ylium (PubChem CID 91146648) has the molecular formula C8H10NS+ and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-3,3a,4,5-tetrahydro-2H-1,3-benzothiazol-5-ylium.
| Compound Name | 2-methyl-3,3a,4,5-tetrahydro-2H-1,3-benzothiazol-5-ylium |
|---|---|
| PubChem CID | 91146648 |
| Molecular Formula | C8H10NS+ |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-methyl-3,3a,4,5-tetrahydro-2H-1,3-benzothiazol-5-ylium |
| SMILES | CC1NC2C[C+]=CC=C2S1 |
| InChI | InChI=1S/C8H10NS/c1-6-9-7-4-2-3-5-8(7)10-6/h3,5-7,9H,4H2,1H3/q+1 |
| InChIKey | PAGUVOWPWKGCHB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|