C28H31F17O4 — CID 91147018
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;1-butan-2-yl-2,3,4,5,6-pentafluorobenzene (PubChem CID 91147018) has the molecular formula C28H31F17O4 and a molecular weight of 754.52 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;1-butan-2-yl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;1-butan-2-yl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 91147018 |
| Molecular Formula | C28H31F17O4 |
| Molecular Weight | 754.52 g/mol |
| Exact Mass | 754.20 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;1-butan-2-yl-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1.CCC(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H22F12O4.C10H9F5/c1-4-12(2,3)11(31)34-10-6-8(13(32,15(19,20)21)16(22,23)24)5-9(7-10)14(33,17(25,26)27)18(28,29)30;1-3-4(2)5-6(11)8(13)10(15)9(14)7(5)12/h8-10,32-33H,4-7H2,1-3H3;4H,3H2,1-2H3 |
| InChIKey | IJZLWQKUKDQOTJ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.52 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|