About 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene
2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene (PubChem CID 91147719) has the molecular formula C23H28ClN3O
and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene.
Molecular Properties
| Compound Name | 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene |
| PubChem CID | 91147719 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene |
| SMILES | CC.COCc1ccccc1.ClCCCc1nc2c(cnc3ccccc32)[nH]1 |
| InChI | InChI=1S/C13H12ClN3.C8H10O.C2H6/c14-7-3-6-12-16-11-8-15-10-5-2-1-4-9(10)13(11)17-12;1-9-7-8-5-3-2-4-6-8;1-2/h1-2,4-5,8H,3,6-7H2,(H,16,17);2-6H,7H2,1H3;1-2H3 |
| InChIKey | TZXNTDSEBLSJTE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene?
The IUPAC name of 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene (CID 91147719) is 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene.
What is the SMILES notation for 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene?
The canonical SMILES for 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene is CC.COCc1ccccc1.ClCCCc1nc2c(cnc3ccccc32)[nH]1.
What is the InChIKey of 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene?
The InChIKey is TZXNTDSEBLSJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3.C8H10O.C2H6/c14-7-3-6-12-16-11-8-15-10-5-2-1-4-9(10)13(11)17-12;1-9-7-8-5-3-2-4-6-8;1-2/h1-2,4-5,8H,3,6-7H2,(H,16,17);2-6H,7H2,1H3;1-2H3.
What are the key properties of 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene?
2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene has a molecular weight of 397.95 g/mol, XLogP of 6.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloropropyl)-3H-imidazo[4,5-c]quinoline;ethane;methoxymethylbenzene is sourced from PubChem (CID 91147719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).