C30H38NO4P — CID 91147890
benzyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate;dimethylphosphorylmethane;[(E)-prop-1-enyl]benzene (PubChem CID 91147890) has the molecular formula C30H38NO4P and a molecular weight of 507.61 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate;dimethylphosphorylmethane;[(E)-prop-1-enyl]benzene.
| Compound Name | benzyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate;dimethylphosphorylmethane;[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 91147890 |
| Molecular Formula | C30H38NO4P |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate;dimethylphosphorylmethane;[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1ccccc1.CP(C)(C)=O.O=C(N[C@@H](Cc1ccccc1)[C@H]1CO1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO3.C9H10.C3H9OP/c20-18(22-12-15-9-5-2-6-10-15)19-16(17-13-21-17)11-14-7-3-1-4-8-14;1-2-6-9-7-4-3-5-8-9;1-5(2,3)4/h1-10,16-17H,11-13H2,(H,19,20);2-8H,1H3;1-3H3/b;6-2+;/t16-,17+;;/m0../s1 |
| InChIKey | JTGFRHUSRMYIEM-ODGKETICSA-N |
| XLogP | 6.88 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|