About 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene
1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene (PubChem CID 91148129) has the molecular formula C8H19NO3
and a molecular weight of 177.24 g/mol. Its IUPAC name is 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene.
Molecular Properties
| Compound Name | 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene |
| PubChem CID | 91148129 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene |
| SMILES | C=CC.CNCC(O)COOC |
| InChI | InChI=1S/C5H13NO3.C3H6/c1-6-3-5(7)4-9-8-2;1-3-2/h5-7H,3-4H2,1-2H3;3H,1H2,2H3 |
| InChIKey | ISRHLPAIBWYSGA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene?
The IUPAC name of 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene (CID 91148129) is 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene.
What is the SMILES notation for 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene?
The canonical SMILES for 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene is C=CC.CNCC(O)COOC.
What is the InChIKey of 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene?
The InChIKey is ISRHLPAIBWYSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO3.C3H6/c1-6-3-5(7)4-9-8-2;1-3-2/h5-7H,3-4H2,1-2H3;3H,1H2,2H3.
What are the key properties of 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene?
1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene has a molecular weight of 177.24 g/mol, XLogP of 0.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)-3-methylperoxypropan-2-ol;prop-1-ene is sourced from PubChem (CID 91148129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).