About 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate
3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate (PubChem CID 91148247) has the molecular formula C19H44O7Si4
and a molecular weight of 496.90 g/mol. Its IUPAC name is 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate.
Molecular Properties
| Compound Name | 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate |
| PubChem CID | 91148247 |
| Molecular Formula | C19H44O7Si4 |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OCCCOCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H44O7Si4/c1-11-18(20)19(21)23-16-12-14-22-15-13-17-30(24-27(2,3)4,25-28(5,6)7)26-29(8,9)10/h11-17H2,1-10H3 |
| InChIKey | VONRQZHDLKTZSM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate?
The IUPAC name of 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate (CID 91148247) is 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate.
What is the SMILES notation for 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate?
The canonical SMILES for 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate is CCC(=O)C(=O)OCCCOCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate?
The InChIKey is VONRQZHDLKTZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H44O7Si4/c1-11-18(20)19(21)23-16-12-14-22-15-13-17-30(24-27(2,3)4,25-28(5,6)7)26-29(8,9)10/h11-17H2,1-10H3.
What are the key properties of 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate?
3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate has a molecular weight of 496.90 g/mol, XLogP of 4.80, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-tris(trimethylsilyloxy)silylpropoxy]propyl 2-oxobutanoate is sourced from PubChem (CID 91148247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).