C22H19Cl2N7OS — CID 91148261
N-[4-[3-cyano-4-(2,4-dichlorophenyl)-5-(N'-methanimidoylcarbamimidoyl)thiophen-2-yl]-2-pyridinyl]-2-(dimethylamino)acetamide (PubChem CID 91148261) has the molecular formula C22H19Cl2N7OS and a molecular weight of 500.42 g/mol. Its IUPAC name is N-[4-[3-cyano-4-(2,4-dichlorophenyl)-5-(N'-methanimidoylcarbamimidoyl)thiophen-2-yl]-2-pyridinyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[4-[3-cyano-4-(2,4-dichlorophenyl)-5-(N'-methanimidoylcarbamimidoyl)thiophen-2-yl]-2-pyridinyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 91148261 |
| Molecular Formula | C22H19Cl2N7OS |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | N-[4-[3-cyano-4-(2,4-dichlorophenyl)-5-(N'-methanimidoylcarbamimidoyl)thiophen-2-yl]-2-pyridinyl]-2-(dimethylamino)acetamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(-c2ccnc(NC(=O)CN(C)C)c2)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H19Cl2N7OS/c1-31(2)10-18(32)30-17-7-12(5-6-28-17)20-15(9-25)19(21(33-20)22(27)29-11-26)14-4-3-13(23)8-16(14)24/h3-8,11H,10H2,1-2H3,(H3,26,27,29)(H,28,30,32) |
| InChIKey | UZUNCNKOVFVMCF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|