About 1,3-difluoroheptane-2,6-diol
1,3-difluoroheptane-2,6-diol (PubChem CID 91148334) has the molecular formula C7H14F2O2
and a molecular weight of 168.18 g/mol. Its IUPAC name is 1,3-difluoroheptane-2,6-diol.
Molecular Properties
| Compound Name | 1,3-difluoroheptane-2,6-diol |
| PubChem CID | 91148334 |
| Molecular Formula | C7H14F2O2 |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1,3-difluoroheptane-2,6-diol |
| SMILES | CC(O)CCC(F)C(O)CF |
| InChI | InChI=1S/C7H14F2O2/c1-5(10)2-3-6(9)7(11)4-8/h5-7,10-11H,2-4H2,1H3 |
| InChIKey | OSJDJRMHGVSZEO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-difluoroheptane-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoroheptane-2,6-diol?
The IUPAC name of 1,3-difluoroheptane-2,6-diol (CID 91148334) is 1,3-difluoroheptane-2,6-diol.
What is the SMILES notation for 1,3-difluoroheptane-2,6-diol?
The canonical SMILES for 1,3-difluoroheptane-2,6-diol is CC(O)CCC(F)C(O)CF.
What is the InChIKey of 1,3-difluoroheptane-2,6-diol?
The InChIKey is OSJDJRMHGVSZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2O2/c1-5(10)2-3-6(9)7(11)4-8/h5-7,10-11H,2-4H2,1H3.
What are the key properties of 1,3-difluoroheptane-2,6-diol?
1,3-difluoroheptane-2,6-diol has a molecular weight of 168.18 g/mol, XLogP of 0.82, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoroheptane-2,6-diol is sourced from PubChem (CID 91148334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).