C19H17O5P — CID 91148528
3,5,7-trimethyl-2-(2-methyl-2-oxo-1,3,2λ5-benzodioxaphosphol-5-yl)chromen-4-one (PubChem CID 91148528) has the molecular formula C19H17O5P and a molecular weight of 356.31 g/mol. Its IUPAC name is 3,5,7-trimethyl-2-(2-methyl-2-oxo-1,3,2λ5-benzodioxaphosphol-5-yl)chromen-4-one.
| Compound Name | 3,5,7-trimethyl-2-(2-methyl-2-oxo-1,3,2λ5-benzodioxaphosphol-5-yl)chromen-4-one |
|---|---|
| PubChem CID | 91148528 |
| Molecular Formula | C19H17O5P |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3,5,7-trimethyl-2-(2-methyl-2-oxo-1,3,2λ5-benzodioxaphosphol-5-yl)chromen-4-one |
| SMILES | Cc1cc(C)c2c(=O)c(C)c(-c3ccc4c(c3)OP(C)(=O)O4)oc2c1 |
| InChI | InChI=1S/C19H17O5P/c1-10-7-11(2)17-16(8-10)22-19(12(3)18(17)20)13-5-6-14-15(9-13)24-25(4,21)23-14/h5-9H,1-4H3 |
| InChIKey | WDGMYICQTGAZGY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|