C31H30N2O4S+2 — CID 91148538
3-(benzenesulfonyl)-8-methyl-2H-1,3-benzoxazin-3-ium;4,8-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium (PubChem CID 91148538) has the molecular formula C31H30N2O4S+2 and a molecular weight of 526.66 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-8-methyl-2H-1,3-benzoxazin-3-ium;4,8-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-(benzenesulfonyl)-8-methyl-2H-1,3-benzoxazin-3-ium;4,8-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91148538 |
| Molecular Formula | C31H30N2O4S+2 |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-(benzenesulfonyl)-8-methyl-2H-1,3-benzoxazin-3-ium;4,8-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
| SMILES | CC1=[N+](c2ccccc2)COc2c(C)cccc21.Cc1cccc2c1OC[N+](S(=O)(=O)c1ccccc1)=C2 |
| InChI | InChI=1S/C16H16NO.C15H14NO3S/c1-12-7-6-10-15-13(2)17(11-18-16(12)15)14-8-4-3-5-9-14;1-12-6-5-7-13-10-16(11-19-15(12)13)20(17,18)14-8-3-2-4-9-14/h3-10H,11H2,1-2H3;2-10H,11H2,1H3/q2*+1 |
| InChIKey | XLXWOZMMAOZLNI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|