About methyl 4H-pyran-3-carboxylate
methyl 4H-pyran-3-carboxylate (PubChem CID 91148663) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is methyl 4H-pyran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4H-pyran-3-carboxylate |
| PubChem CID | 91148663 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | methyl 4H-pyran-3-carboxylate |
| SMILES | COC(=O)C1=COC=CC1 |
| InChI | InChI=1S/C7H8O3/c1-9-7(8)6-3-2-4-10-5-6/h2,4-5H,3H2,1H3 |
| InChIKey | YKBJVFUTXYJELQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4H-pyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4H-pyran-3-carboxylate?
The IUPAC name of methyl 4H-pyran-3-carboxylate (CID 91148663) is methyl 4H-pyran-3-carboxylate.
What is the SMILES notation for methyl 4H-pyran-3-carboxylate?
The canonical SMILES for methyl 4H-pyran-3-carboxylate is COC(=O)C1=COC=CC1.
What is the InChIKey of methyl 4H-pyran-3-carboxylate?
The InChIKey is YKBJVFUTXYJELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-9-7(8)6-3-2-4-10-5-6/h2,4-5H,3H2,1H3.
What are the key properties of methyl 4H-pyran-3-carboxylate?
methyl 4H-pyran-3-carboxylate has a molecular weight of 140.14 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-pyran-3-carboxylate is sourced from PubChem (CID 91148663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).