C16H16N2O — CID 91149332
7,9-dimethyl-7,9-diazatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaen-8-one (PubChem CID 91149332) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 7,9-dimethyl-7,9-diazatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaen-8-one.
| Compound Name | 7,9-dimethyl-7,9-diazatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaen-8-one |
|---|---|
| PubChem CID | 91149332 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 7,9-dimethyl-7,9-diazatricyclo[8.2.2.23,6]hexadeca-1(12),3(16),4,6(15),10,13-hexaen-8-one |
| SMILES | CN1C(=O)N(C)c2ccc(cc2)Cc2ccc1cc2 |
| InChI | InChI=1S/C16H16N2O/c1-17-14-7-3-12(4-8-14)11-13-5-9-15(10-6-13)18(2)16(17)19/h3-10H,11H2,1-2H3 |
| InChIKey | FOPPMMFREHTFAI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |