C13H14Cl2N2 — CID 91149338
5-butyl-2-(2,3-dichlorophenyl)-1H-imidazole (PubChem CID 91149338) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.18 g/mol. Its IUPAC name is 5-butyl-2-(2,3-dichlorophenyl)-1H-imidazole.
| Compound Name | 5-butyl-2-(2,3-dichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 91149338 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-butyl-2-(2,3-dichlorophenyl)-1H-imidazole |
| SMILES | CCCCc1cnc(-c2cccc(Cl)c2Cl)[nH]1 |
| InChI | InChI=1S/C13H14Cl2N2/c1-2-3-5-9-8-16-13(17-9)10-6-4-7-11(14)12(10)15/h4,6-8H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | BCJCMLAUGVMWQE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |