About 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile
2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile (PubChem CID 91149383) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile.
Molecular Properties
| Compound Name | 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile |
| PubChem CID | 91149383 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile |
| SMILES | CCCC(C#N)=C1CC(C)(C)c2ccc(C)cc21 |
| InChI | InChI=1S/C17H21N/c1-5-6-13(11-18)15-10-17(3,4)16-8-7-12(2)9-14(15)16/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | LFSAWZSYUYHFJU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile?
The IUPAC name of 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile (CID 91149383) is 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile.
What is the SMILES notation for 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile?
The canonical SMILES for 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile is CCCC(C#N)=C1CC(C)(C)c2ccc(C)cc21.
What is the InChIKey of 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile?
The InChIKey is LFSAWZSYUYHFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-5-6-13(11-18)15-10-17(3,4)16-8-7-12(2)9-14(15)16/h7-9H,5-6,10H2,1-4H3.
What are the key properties of 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile?
2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile has a molecular weight of 239.36 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,6-trimethyl-2H-inden-1-ylidene)pentanenitrile is sourced from PubChem (CID 91149383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).