About 1-hex-5-ynyl-2,3,5-trimethylbenzene
1-hex-5-ynyl-2,3,5-trimethylbenzene (PubChem CID 91149664) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-hex-5-ynyl-2,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-hex-5-ynyl-2,3,5-trimethylbenzene |
| PubChem CID | 91149664 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-hex-5-ynyl-2,3,5-trimethylbenzene |
| SMILES | C#CCCCCc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C15H20/c1-5-6-7-8-9-15-11-12(2)10-13(3)14(15)4/h1,10-11H,6-9H2,2-4H3 |
| InChIKey | KCBPAUMISRKUKW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-5-ynyl-2,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-5-ynyl-2,3,5-trimethylbenzene?
The IUPAC name of 1-hex-5-ynyl-2,3,5-trimethylbenzene (CID 91149664) is 1-hex-5-ynyl-2,3,5-trimethylbenzene.
What is the SMILES notation for 1-hex-5-ynyl-2,3,5-trimethylbenzene?
The canonical SMILES for 1-hex-5-ynyl-2,3,5-trimethylbenzene is C#CCCCCc1cc(C)cc(C)c1C.
What is the InChIKey of 1-hex-5-ynyl-2,3,5-trimethylbenzene?
The InChIKey is KCBPAUMISRKUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-5-6-7-8-9-15-11-12(2)10-13(3)14(15)4/h1,10-11H,6-9H2,2-4H3.
What are the key properties of 1-hex-5-ynyl-2,3,5-trimethylbenzene?
1-hex-5-ynyl-2,3,5-trimethylbenzene has a molecular weight of 200.32 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-5-ynyl-2,3,5-trimethylbenzene is sourced from PubChem (CID 91149664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).