C24H23FN6O3 — CID 91149810
[4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(4-nitrophenyl)-6,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone (PubChem CID 91149810) has the molecular formula C24H23FN6O3 and a molecular weight of 462.49 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(4-nitrophenyl)-6,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(4-nitrophenyl)-6,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone |
|---|---|
| PubChem CID | 91149810 |
| Molecular Formula | C24H23FN6O3 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(4-nitrophenyl)-6,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone |
| SMILES | CC1=Nc2ccnn2C(c2ccc([N+](=O)[O-])cc2)C1C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23FN6O3/c1-16-22(24(32)29-14-12-28(13-15-29)19-8-4-18(25)5-9-19)23(30-21(27-16)10-11-26-30)17-2-6-20(7-3-17)31(33)34/h2-11,22-23H,12-15H2,1H3 |
| InChIKey | WSEGZGPLZXIHOD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|