C21H22N4O5 — CID 91149865
4-(2-methoxyethoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-1H-benzimidazole-2-carboxamide (PubChem CID 91149865) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | 4-(2-methoxyethoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 91149865 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-1H-benzimidazole-2-carboxamide |
| SMILES | COCCOc1cccc2[nH]c(C(=O)Nc3ccc(N4CCOCC4=O)cc3)nc12 |
| InChI | InChI=1S/C21H22N4O5/c1-28-11-12-30-17-4-2-3-16-19(17)24-20(23-16)21(27)22-14-5-7-15(8-6-14)25-9-10-29-13-18(25)26/h2-8H,9-13H2,1H3,(H,22,27)(H,23,24) |
| InChIKey | XJLCVFFCPREGSK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|