About pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione
pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 91149899) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
Molecular Properties
| Compound Name | pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| PubChem CID | 91149899 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCCCC.O=C1CC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H10O2.C5H12/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-3-5-4-2/h1-2,5-6,9-10H,3-4H2;3-5H2,1-2H3 |
| InChIKey | SJYHPOVAILBWGH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The IUPAC name of pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CID 91149899) is pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
What is the SMILES notation for pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The canonical SMILES for pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is CCCCC.O=C1CC(=O)C2C3C=CC(C3)C12.
What is the InChIKey of pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The InChIKey is SJYHPOVAILBWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C5H12/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-3-5-4-2/h1-2,5-6,9-10H,3-4H2;3-5H2,1-2H3.
What are the key properties of pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione has a molecular weight of 234.34 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is sourced from PubChem (CID 91149899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).