C7H14O5 — CID 91150207
(3S,4R,5R)-1,3,4,5-tetrahydroxy-3-methylhexan-2-one (PubChem CID 91150207) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (3S,4R,5R)-1,3,4,5-tetrahydroxy-3-methylhexan-2-one.
| Compound Name | (3S,4R,5R)-1,3,4,5-tetrahydroxy-3-methylhexan-2-one |
|---|---|
| PubChem CID | 91150207 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5-tetrahydroxy-3-methylhexan-2-one |
| SMILES | C[C@@H](O)[C@@H](O)[C@](C)(O)C(=O)CO |
| InChI | InChI=1S/C7H14O5/c1-4(9)6(11)7(2,12)5(10)3-8/h4,6,8-9,11-12H,3H2,1-2H3/t4-,6-,7-/m1/s1 |
| InChIKey | SXOJLTBGEJEWAN-QPPQHZFASA-N |
| XLogP | -1.96 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |