About tricyclo[3.3.1.03,7]non-1-ene
tricyclo[3.3.1.03,7]non-1-ene (PubChem CID 91150339) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is tricyclo[3.3.1.03,7]non-1-ene.
Molecular Properties
| Compound Name | tricyclo[3.3.1.03,7]non-1-ene |
| PubChem CID | 91150339 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | tricyclo[3.3.1.03,7]non-1-ene |
| SMILES | C1=C2CC3CC1C(C2)C3 |
| InChI | InChI=1S/C9H12/c1-6-2-8-4-7(1)5-9(8)3-6/h2,7-9H,1,3-5H2 |
| InChIKey | CRSNKLBHGLGAIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[3.3.1.03,7]non-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[3.3.1.03,7]non-1-ene?
The IUPAC name of tricyclo[3.3.1.03,7]non-1-ene (CID 91150339) is tricyclo[3.3.1.03,7]non-1-ene.
What is the SMILES notation for tricyclo[3.3.1.03,7]non-1-ene?
The canonical SMILES for tricyclo[3.3.1.03,7]non-1-ene is C1=C2CC3CC1C(C2)C3.
What is the InChIKey of tricyclo[3.3.1.03,7]non-1-ene?
The InChIKey is CRSNKLBHGLGAIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-6-2-8-4-7(1)5-9(8)3-6/h2,7-9H,1,3-5H2.
What are the key properties of tricyclo[3.3.1.03,7]non-1-ene?
tricyclo[3.3.1.03,7]non-1-ene has a molecular weight of 120.19 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[3.3.1.03,7]non-1-ene is sourced from PubChem (CID 91150339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).