C16H30O11 — CID 91150760
(2R,3R,5S)-1,2,5,6-tetrahydroxy-7,7-dimethyl-3-[(2S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-4-one (PubChem CID 91150760) has the molecular formula C16H30O11 and a molecular weight of 398.41 g/mol. Its IUPAC name is (2R,3R,5S)-1,2,5,6-tetrahydroxy-7,7-dimethyl-3-[(2S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-4-one.
| Compound Name | (2R,3R,5S)-1,2,5,6-tetrahydroxy-7,7-dimethyl-3-[(2S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-4-one |
|---|---|
| PubChem CID | 91150760 |
| Molecular Formula | C16H30O11 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2R,3R,5S)-1,2,5,6-tetrahydroxy-7,7-dimethyl-3-[(2S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctan-4-one |
| SMILES | CC(C)(C)C(O)[C@H](O)C(=O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)C1O)[C@H](O)CO |
| InChI | InChI=1S/C16H30O11/c1-16(2,3)14(25)11(23)10(22)13(6(19)4-17)27-15-12(24)9(21)8(20)7(5-18)26-15/h6-9,11-15,17-21,23-25H,4-5H2,1-3H3/t6-,7-,8+,9+,11-,12?,13-,14?,15+/m1/s1 |
| InChIKey | MSIZIRSRWPULFU-RCSRMJAQSA-N |
| XLogP | -4.14 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |