C26H40O3S — CID 91150852
(1S)-5-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1-(3-hydroxy-3-methylbutyl)sulfanyl-4-methylidenecyclohexane-1,2-diol (PubChem CID 91150852) has the molecular formula C26H40O3S and a molecular weight of 432.67 g/mol. Its IUPAC name is (1S)-5-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1-(3-hydroxy-3-methylbutyl)sulfanyl-4-methylidenecyclohexane-1,2-diol.
| Compound Name | (1S)-5-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1-(3-hydroxy-3-methylbutyl)sulfanyl-4-methylidenecyclohexane-1,2-diol |
|---|---|
| PubChem CID | 91150852 |
| Molecular Formula | C26H40O3S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (1S)-5-[2-[(3aS,7aS)-1-ethyl-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-1-(3-hydroxy-3-methylbutyl)sulfanyl-4-methylidenecyclohexane-1,2-diol |
| SMILES | C=C1CC(O)[C@@](O)(SCCC(C)(C)O)CC1=CC=C1CCC[C@]2(C)C(CC)=CC[C@@H]12 |
| InChI | InChI=1S/C26H40O3S/c1-6-21-11-12-22-19(8-7-13-25(21,22)5)9-10-20-17-26(29,23(27)16-18(20)2)30-15-14-24(3,4)28/h9-11,22-23,27-29H,2,6-8,12-17H2,1,3-5H3/t22-,23?,25+,26-/m0/s1 |
| InChIKey | FEMDLFBQOQWBDY-FBBPCMQYSA-N |
| XLogP | 5.68 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|