C37H19Br3F25I — CID 91150965
1-bromo-4-(4-bromophenyl)benzene;1-bromo-4-(4-methylphenyl)benzene;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane (PubChem CID 91150965) has the molecular formula C37H19Br3F25I and a molecular weight of 1305.12 g/mol. Its IUPAC name is 1-bromo-4-(4-bromophenyl)benzene;1-bromo-4-(4-methylphenyl)benzene;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane.
| Compound Name | 1-bromo-4-(4-bromophenyl)benzene;1-bromo-4-(4-methylphenyl)benzene;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane |
|---|---|
| PubChem CID | 91150965 |
| Molecular Formula | C37H19Br3F25I |
| Molecular Weight | 1305.12 g/mol |
| Exact Mass | 1301.77 |
| IUPAC Name | 1-bromo-4-(4-bromophenyl)benzene;1-bromo-4-(4-methylphenyl)benzene;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane |
| SMILES | Brc1ccc(-c2ccc(Br)cc2)cc1.Cc1ccc(-c2ccc(Br)cc2)cc1.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C13H11Br.C12H8Br2.C12F25I/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;13-1(14,3(17,18)5(21,22)7(25,26)9(29,30)11(33,34)35)2(15,16)4(19,20)6(23,24)8(27,28)10(31,32)12(36,37)38/h2-9H,1H3;1-8H; |
| InChIKey | RXVZLKUOTLENQH-UHFFFAOYSA-N |
| XLogP | 18.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1305.12 |
| LogP ≤ 5 | 18.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|