C32H47F6N — CID 91151617
7,7,8,8,8-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methyloctan-1-amine (PubChem CID 91151617) has the molecular formula C32H47F6N and a molecular weight of 559.72 g/mol. Its IUPAC name is 7,7,8,8,8-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methyloctan-1-amine.
| Compound Name | 7,7,8,8,8-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methyloctan-1-amine |
|---|---|
| PubChem CID | 91151617 |
| Molecular Formula | C32H47F6N |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.36 |
| IUPAC Name | 7,7,8,8,8-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methyloctan-1-amine |
| SMILES | CN(CCCCCCC(F)(F)C(F)(F)F)CCCCC[C@@H]1Cc2ccccc2[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)C[C@@H]2F |
| InChI | InChI=1S/C32H47F6N/c1-30-17-12-16-26(30)28-24(21-23-13-7-8-15-25(23)29(28)27(33)22-30)14-6-5-11-20-39(2)19-10-4-3-9-18-31(34,35)32(36,37)38/h7-8,13,15,24,26-29H,3-6,9-12,14,16-22H2,1-2H3/t24-,26+,27+,28+,29+,30+/m1/s1 |
| InChIKey | BQSRFNSGRXUYLA-MFHFOAAOSA-N |
| XLogP | 9.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|