C25H27N3O12S2 — CID 91152013
2-[[5-[2-(2-amino-3,5,6-trihydroxy-4-methylphenyl)propan-2-yl]thiophen-2-yl]sulfonylamino]-3-(2,4,5,6,7-pentahydroxy-1H-indol-3-yl)propanoic acid (PubChem CID 91152013) has the molecular formula C25H27N3O12S2 and a molecular weight of 625.63 g/mol. Its IUPAC name is 2-[[5-[2-(2-amino-3,5,6-trihydroxy-4-methylphenyl)propan-2-yl]thiophen-2-yl]sulfonylamino]-3-(2,4,5,6,7-pentahydroxy-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[5-[2-(2-amino-3,5,6-trihydroxy-4-methylphenyl)propan-2-yl]thiophen-2-yl]sulfonylamino]-3-(2,4,5,6,7-pentahydroxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 91152013 |
| Molecular Formula | C25H27N3O12S2 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 2-[[5-[2-(2-amino-3,5,6-trihydroxy-4-methylphenyl)propan-2-yl]thiophen-2-yl]sulfonylamino]-3-(2,4,5,6,7-pentahydroxy-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1c(O)c(N)c(C(C)(C)c2ccc(S(=O)(=O)NC(Cc3c(O)[nH]c4c(O)c(O)c(O)c(O)c34)C(=O)O)s2)c(O)c1O |
| InChI | InChI=1S/C25H27N3O12S2/c1-7-16(29)14(26)13(19(32)17(7)30)25(2,3)10-4-5-11(41-10)42(39,40)28-9(24(37)38)6-8-12-15(27-23(8)36)20(33)22(35)21(34)18(12)31/h4-5,9,27-36H,6,26H2,1-3H3,(H,37,38) |
| InChIKey | HCWOKXCFJZFWRN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 287.12 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|