About (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol
(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol (PubChem CID 9115255) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol.
Analyze (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The IUPAC name of (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol (CID 9115255) is (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol.
What is the SMILES notation for (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The canonical SMILES for (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is Cc1cn2c(CO)c(C)nc2s1.
What is the InChIKey of (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The InChIKey is JJMMPXPZBLFCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-5-3-10-7(4-11)6(2)9-8(10)12-5/h3,11H,4H2,1-2H3.
What are the key properties of (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol has a molecular weight of 182.25 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is sourced from PubChem (CID 9115255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).