C21H21NO4 — CID 91152871
(5R)-3-[(2R)-2-amino-3-phenylpropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 91152871) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (5R)-3-[(2R)-2-amino-3-phenylpropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione.
| Compound Name | (5R)-3-[(2R)-2-amino-3-phenylpropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 91152871 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (5R)-3-[(2R)-2-amino-3-phenylpropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | N[C@H](Cc1ccccc1)C(=O)C1C(=O)O[C@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C21H21NO4/c22-16(13-15-9-5-2-6-10-15)19(23)18-20(24)17(26-21(18)25)12-11-14-7-3-1-4-8-14/h1-10,16-18H,11-13,22H2/t16-,17-,18?/m1/s1 |
| InChIKey | PUZPFKHJUZZTLO-OWZOALSMSA-N |
| XLogP | 1.87 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|