C14H28O3 — CID 91153078
2-butyl-2,4,4-trimethyl-5-oxohexanal;methanol (PubChem CID 91153078) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-butyl-2,4,4-trimethyl-5-oxohexanal;methanol.
| Compound Name | 2-butyl-2,4,4-trimethyl-5-oxohexanal;methanol |
|---|---|
| PubChem CID | 91153078 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-butyl-2,4,4-trimethyl-5-oxohexanal;methanol |
| SMILES | CCCCC(C)(C=O)CC(C)(C)C(C)=O.CO |
| InChI | InChI=1S/C13H24O2.CH4O/c1-6-7-8-13(5,10-14)9-12(3,4)11(2)15;1-2/h10H,6-9H2,1-5H3;2H,1H3 |
| InChIKey | YRTCUQKPMKFUEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|