About [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate
[4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate (PubChem CID 91153232) has the molecular formula C18H14F2N2O3S
and a molecular weight of 376.38 g/mol. Its IUPAC name is [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate |
| PubChem CID | 91153232 |
| Molecular Formula | C18H14F2N2O3S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate |
| SMILES | COCc1csc(OC(=O)c2cc(-c3cc(F)cc(F)c3)cc(C)n2)n1 |
| InChI | InChI=1S/C18H14F2N2O3S/c1-10-3-11(12-4-13(19)7-14(20)5-12)6-16(21-10)17(23)25-18-22-15(8-24-2)9-26-18/h3-7,9H,8H2,1-2H3 |
| InChIKey | ROYVCIVFCJMQDN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate?
The IUPAC name of [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate (CID 91153232) is [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate.
What is the SMILES notation for [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate?
The canonical SMILES for [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate is COCc1csc(OC(=O)c2cc(-c3cc(F)cc(F)c3)cc(C)n2)n1.
What is the InChIKey of [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate?
The InChIKey is ROYVCIVFCJMQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2O3S/c1-10-3-11(12-4-13(19)7-14(20)5-12)6-16(21-10)17(23)25-18-22-15(8-24-2)9-26-18/h3-7,9H,8H2,1-2H3.
What are the key properties of [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate?
[4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate has a molecular weight of 376.38 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxymethyl)-1,3-thiazol-2-yl] 4-(3,5-difluorophenyl)-6-methylpyridine-2-carboxylate is sourced from PubChem (CID 91153232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).