About 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid
2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid (PubChem CID 91153241) has the molecular formula C12H8Br2O6S2
and a molecular weight of 472.13 g/mol. Its IUPAC name is 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid |
| PubChem CID | 91153241 |
| Molecular Formula | C12H8Br2O6S2 |
| Molecular Weight | 472.13 g/mol |
| Exact Mass | 469.81 |
| IUPAC Name | 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Br)c(Br)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H8Br2O6S2/c13-9-6-7-10(21(15,16)17)12(11(9)14)20-22(18,19)8-4-2-1-3-5-8/h1-7H,(H,15,16,17) |
| InChIKey | PQFMJXGORJSUNS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid?
The IUPAC name of 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid (CID 91153241) is 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid.
What is the SMILES notation for 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid?
The canonical SMILES for 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid is O=S(=O)(O)c1ccc(Br)c(Br)c1OS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid?
The InChIKey is PQFMJXGORJSUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Br2O6S2/c13-9-6-7-10(21(15,16)17)12(11(9)14)20-22(18,19)8-4-2-1-3-5-8/h1-7H,(H,15,16,17).
What are the key properties of 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid?
2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid has a molecular weight of 472.13 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyloxy)-3,4-dibromobenzenesulfonic acid is sourced from PubChem (CID 91153241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).