C51H46N3O3+3 — CID 91153576
3,8-diphenyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(2-methylphenyl)-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-2H-1,3-benzoxazin-3-ium (PubChem CID 91153576) has the molecular formula C51H46N3O3+3 and a molecular weight of 748.95 g/mol. Its IUPAC name is 3,8-diphenyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(2-methylphenyl)-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3,8-diphenyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(2-methylphenyl)-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91153576 |
| Molecular Formula | C51H46N3O3+3 |
| Molecular Weight | 748.95 g/mol |
| Exact Mass | 748.35 |
| IUPAC Name | 3,8-diphenyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(2-methylphenyl)-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
| SMILES | C1=[N+](c2ccccc2)COc2c1cccc2-c1ccccc1.Cc1cccc2c1OC[N+](c1ccccc1)=C2.Cc1ccccc1[N+]1=Cc2cccc(C)c2OC1 |
| InChI | InChI=1S/C20H16NO.C16H16NO.C15H14NO/c1-3-8-16(9-4-1)19-13-7-10-17-14-21(15-22-20(17)19)18-11-5-2-6-12-18;1-12-6-3-4-9-15(12)17-10-14-8-5-7-13(2)16(14)18-11-17;1-12-6-5-7-13-10-16(11-17-15(12)13)14-8-3-2-4-9-14/h1-14H,15H2;3-10H,11H2,1-2H3;2-10H,11H2,1H3/q3*+1 |
| InChIKey | DARNYJSTLXNYGX-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 36.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.95 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|