C22H42O2Si2 — CID 91153667
(7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyltrideca-3,5-dien-1-yn-7-ol (PubChem CID 91153667) has the molecular formula C22H42O2Si2 and a molecular weight of 394.75 g/mol. Its IUPAC name is (7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyltrideca-3,5-dien-1-yn-7-ol.
| Compound Name | (7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyltrideca-3,5-dien-1-yn-7-ol |
|---|---|
| PubChem CID | 91153667 |
| Molecular Formula | C22H42O2Si2 |
| Molecular Weight | 394.75 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilyltrideca-3,5-dien-1-yn-7-ol |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)C=CC=CC#C[Si](C)(C)C |
| InChI | InChI=1S/C22H42O2Si2/c1-10-11-14-18-21(24-26(8,9)22(2,3)4)20(23)17-15-12-13-16-19-25(5,6)7/h12-13,15,17,20-21,23H,10-11,14,18H2,1-9H3/t20-,21+/m1/s1 |
| InChIKey | DGWPDJFJWDEMOX-RTWAWAEBSA-N |
| XLogP | 6.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|