C25H40O3 — CID 91154147
10'-ethyl-5,13',17'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol (PubChem CID 91154147) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is 10'-ethyl-5,13',17'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol.
| Compound Name | 10'-ethyl-5,13',17'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol |
|---|---|
| PubChem CID | 91154147 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 10'-ethyl-5,13',17'-trimethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol |
| SMILES | CCC12CCC3(CC1(O)CCC1C2=CCC2(C)C(C)CCC12)OCC(C)CO3 |
| InChI | InChI=1S/C25H40O3/c1-5-23-12-13-25(27-14-17(2)15-28-25)16-24(23,26)11-8-19-20-7-6-18(3)22(20,4)10-9-21(19)23/h9,17-20,26H,5-8,10-16H2,1-4H3 |
| InChIKey | JJNCXPMFVQUWNX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|