C30H42FNO9 — CID 91154229
tert-butyl N-[(5S,9R,13R,14S)-11-fluoro-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]-N-methylcarbamate (PubChem CID 91154229) has the molecular formula C30H42FNO9 and a molecular weight of 579.66 g/mol. Its IUPAC name is tert-butyl N-[(5S,9R,13R,14S)-11-fluoro-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5S,9R,13R,14S)-11-fluoro-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91154229 |
| Molecular Formula | C30H42FNO9 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | tert-butyl N-[(5S,9R,13R,14S)-11-fluoro-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]-N-methylcarbamate |
| SMILES | COCOc1cc(N(C)C(=O)OC(C)(C)C)cc2c1C(=O)O[C@@H](C)[C@H](C)C=C(F)C(O)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C30H42FNO9/c1-17-13-21(31)25(33)26-22(39-30(6,7)40-26)12-10-11-19-14-20(32(8)28(35)41-29(3,4)5)15-23(37-16-36-9)24(19)27(34)38-18(17)2/h10-11,13-15,17-18,22,25-26,33H,12,16H2,1-9H3/t17-,18+,22+,25?,26+/m1/s1 |
| InChIKey | PBVUEQZKPXAICR-BVYNZWOISA-N |
| XLogP | 5.37 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|