About ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane
ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane (PubChem CID 91155325) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane.
Molecular Properties
| Compound Name | ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane |
| PubChem CID | 91155325 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane |
| SMILES | CC.CC(C)=C(C)C1(C)OC1(C)C |
| InChI | InChI=1S/C10H18O.C2H6/c1-7(2)8(3)10(6)9(4,5)11-10;1-2/h1-6H3;1-2H3 |
| InChIKey | AKZHYHCFQYEORA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane?
The IUPAC name of ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane (CID 91155325) is ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane.
What is the SMILES notation for ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane?
The canonical SMILES for ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane is CC.CC(C)=C(C)C1(C)OC1(C)C.
What is the InChIKey of ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane?
The InChIKey is AKZHYHCFQYEORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C2H6/c1-7(2)8(3)10(6)9(4,5)11-10;1-2/h1-6H3;1-2H3.
What are the key properties of ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane?
ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane has a molecular weight of 184.32 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,2,3-trimethyl-3-(3-methylbut-2-en-2-yl)oxirane is sourced from PubChem (CID 91155325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).