About 2-N,3-N-diethyloxirane-2,3-dicarboxamide
2-N,3-N-diethyloxirane-2,3-dicarboxamide (PubChem CID 91155751) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-N,3-N-diethyloxirane-2,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,3-N-diethyloxirane-2,3-dicarboxamide |
| PubChem CID | 91155751 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-N,3-N-diethyloxirane-2,3-dicarboxamide |
| SMILES | CCNC(=O)C1OC1C(=O)NCC |
| InChI | InChI=1S/C8H14N2O3/c1-3-9-7(11)5-6(13-5)8(12)10-4-2/h5-6H,3-4H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | ROCCBLUEJBAVFN-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-diethyloxirane-2,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-diethyloxirane-2,3-dicarboxamide?
The IUPAC name of 2-N,3-N-diethyloxirane-2,3-dicarboxamide (CID 91155751) is 2-N,3-N-diethyloxirane-2,3-dicarboxamide.
What is the SMILES notation for 2-N,3-N-diethyloxirane-2,3-dicarboxamide?
The canonical SMILES for 2-N,3-N-diethyloxirane-2,3-dicarboxamide is CCNC(=O)C1OC1C(=O)NCC.
What is the InChIKey of 2-N,3-N-diethyloxirane-2,3-dicarboxamide?
The InChIKey is ROCCBLUEJBAVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-3-9-7(11)5-6(13-5)8(12)10-4-2/h5-6H,3-4H2,1-2H3,(H,9,11)(H,10,12).
What are the key properties of 2-N,3-N-diethyloxirane-2,3-dicarboxamide?
2-N,3-N-diethyloxirane-2,3-dicarboxamide has a molecular weight of 186.21 g/mol, XLogP of -0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-diethyloxirane-2,3-dicarboxamide is sourced from PubChem (CID 91155751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).