C9H18N4 — CID 91155754
N,N-diethyl-1-(triazol-1-yl)propan-1-amine (PubChem CID 91155754) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N,N-diethyl-1-(triazol-1-yl)propan-1-amine.
| Compound Name | N,N-diethyl-1-(triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 91155754 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N,N-diethyl-1-(triazol-1-yl)propan-1-amine |
| SMILES | CCC(N(CC)CC)n1ccnn1 |
| InChI | InChI=1S/C9H18N4/c1-4-9(12(5-2)6-3)13-8-7-10-11-13/h7-9H,4-6H2,1-3H3 |
| InChIKey | PWIMDQQTCDRSAC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |