C23H17F2NO3S — CID 91155758
1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrrol-2-ol (PubChem CID 91155758) has the molecular formula C23H17F2NO3S and a molecular weight of 425.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrrol-2-ol.
| Compound Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrrol-2-ol |
|---|---|
| PubChem CID | 91155758 |
| Molecular Formula | C23H17F2NO3S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pyrrol-2-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2cn(-c3ccccc3F)c(O)c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H17F2NO3S/c1-30(28,29)18-12-8-15(9-13-18)19-14-26(21-5-3-2-4-20(21)25)23(27)22(19)16-6-10-17(24)11-7-16/h2-14,27H,1H3 |
| InChIKey | RVLIALVOJSJFOI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |