C17H26BrN2O5P — CID 91156065
[3-(5-bromo-2-pyridinyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate (PubChem CID 91156065) has the molecular formula C17H26BrN2O5P and a molecular weight of 449.28 g/mol. Its IUPAC name is [3-(5-bromo-2-pyridinyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate.
| Compound Name | [3-(5-bromo-2-pyridinyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 91156065 |
| Molecular Formula | C17H26BrN2O5P |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | [3-(5-bromo-2-pyridinyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCC1C=C(c2ccc(Br)cn2)NO1)OC(C)(C)C |
| InChI | InChI=1S/C17H26BrN2O5P/c1-16(2,3)24-26(21,25-17(4,5)6)22-11-13-9-15(20-23-13)14-8-7-12(18)10-19-14/h7-10,13,20H,11H2,1-6H3 |
| InChIKey | BXOVJBMCPUXIDT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|