C46H60F2O5S2 — CID 91156523
[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(4,6-difluorohexa-2,4-dien-3-yl)benzoate (PubChem CID 91156523) has the molecular formula C46H60F2O5S2 and a molecular weight of 795.11 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(4,6-difluorohexa-2,4-dien-3-yl)benzoate.
| Compound Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(4,6-difluorohexa-2,4-dien-3-yl)benzoate |
|---|---|
| PubChem CID | 91156523 |
| Molecular Formula | C46H60F2O5S2 |
| Molecular Weight | 795.11 g/mol |
| Exact Mass | 794.39 |
| IUPAC Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(4,6-difluorohexa-2,4-dien-3-yl)benzoate |
| SMILES | CC=C(C(F)=CCF)c1ccc(OC(C)=O)c(C(=O)Oc2c(C(C)(C)C)cc(SC(C)(C)Sc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cc2C(C)(C)C)c1 |
| InChI | InChI=1S/C46H60F2O5S2/c1-17-31(37(48)20-21-47)28-18-19-38(52-27(2)49)32(22-28)41(51)53-40-35(44(9,10)11)25-30(26-36(40)45(12,13)14)55-46(15,16)54-29-23-33(42(3,4)5)39(50)34(24-29)43(6,7)8/h17-20,22-26,50H,21H2,1-16H3 |
| InChIKey | WQICZJVEVMQOJN-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.11 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|