About (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene
(E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene (PubChem CID 91156885) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene |
| PubChem CID | 91156885 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene |
| SMILES | C/C=C(\C)N.CC1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C9H16.C4H9N/c1-8-5-4-6-9(2,3)7-8;1-3-4(2)5/h5H,4,6-7H2,1-3H3;3H,5H2,1-2H3/b;4-3+ |
| InChIKey | IEQPBUPIOATDEB-SCBDLNNBSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene?
The IUPAC name of (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene (CID 91156885) is (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene.
What is the SMILES notation for (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene?
The canonical SMILES for (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene is C/C=C(\C)N.CC1=CCCC(C)(C)C1.
What is the InChIKey of (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene?
The InChIKey is IEQPBUPIOATDEB-SCBDLNNBSA-N. The full InChI is InChI=1S/C9H16.C4H9N/c1-8-5-4-6-9(2,3)7-8;1-3-4(2)5/h5H,4,6-7H2,1-3H3;3H,5H2,1-2H3/b;4-3+.
What are the key properties of (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene?
(E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene has a molecular weight of 195.35 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-en-2-amine;1,5,5-trimethylcyclohexene is sourced from PubChem (CID 91156885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).