About 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole
4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole (PubChem CID 911572) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 911572 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCCl |
| InChI | InChI=1S/C7H11ClN2/c1-5-7(3-4-8)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10) |
| InChIKey | CLKLSRDKPNOWAM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole (CID 911572) is 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole is Cc1n[nH]c(C)c1CCCl.
What is the InChIKey of 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole?
The InChIKey is CLKLSRDKPNOWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2/c1-5-7(3-4-8)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10).
What are the key properties of 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole?
4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole has a molecular weight of 158.63 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 911572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).